C19H30BClN2O5 — CID 167708157
[(3R,4S,6S)-6-chloro-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 167708157) has the molecular formula C19H30BClN2O5 and a molecular weight of 412.72 g/mol. Its IUPAC name is [(3R,4S,6S)-6-chloro-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-6-chloro-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167708157 |
| Molecular Formula | C19H30BClN2O5 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [(3R,4S,6S)-6-chloro-3,5-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](Cl)C(C)[C@@H](n2cc(B3OC(C)(C)C(C)(C)O3)cn2)[C@H]1C |
| InChI | InChI=1S/C19H30BClN2O5/c1-11-15(10-25-13(3)24)26-17(21)12(2)16(11)23-9-14(8-22-23)20-27-18(4,5)19(6,7)28-20/h8-9,11-12,15-17H,10H2,1-7H3/t11-,12?,15?,16-,17+/m0/s1 |
| InChIKey | ZKOFLIQAVLXOGO-JJDYJZNPSA-N |
| XLogP | 2.52 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|