C17H18ClN5O5S — CID 159588233
[(3R,5S,6R)-5-acetyloxy-4-azido-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-3-methyloxan-2-yl]methyl acetate (PubChem CID 159588233) has the molecular formula C17H18ClN5O5S and a molecular weight of 439.88 g/mol. Its IUPAC name is [(3R,5S,6R)-5-acetyloxy-4-azido-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6R)-5-acetyloxy-4-azido-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 159588233 |
| Molecular Formula | C17H18ClN5O5S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [(3R,5S,6R)-5-acetyloxy-4-azido-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cnc(C#N)c(Cl)c2)[C@@H](OC(C)=O)C(N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C17H18ClN5O5S/c1-8-14(7-26-9(2)24)28-17(16(27-10(3)25)15(8)22-23-20)29-11-4-12(18)13(5-19)21-6-11/h4,6,8,14-17H,7H2,1-3H3/t8-,14?,15?,16-,17+/m0/s1 |
| InChIKey | HPJGGIRABLBNCK-VLJGSELGSA-N |
| XLogP | 3.23 |
| TPSA | 147.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|