C23H22Cl2N6O7S2 — CID 155251504
[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-4-[4-(4-chloro-5H-1,3-thiazol-4-yl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 155251504) has the molecular formula C23H22Cl2N6O7S2 and a molecular weight of 629.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-4-[4-(4-chloro-5H-1,3-thiazol-4-yl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-4-[4-(4-chloro-5H-1,3-thiazol-4-yl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155251504 |
| Molecular Formula | C23H22Cl2N6O7S2 |
| Molecular Weight | 629.50 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-[(5-chloro-6-cyano-3-pyridinyl)sulfanyl]-4-[4-(4-chloro-5H-1,3-thiazol-4-yl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2cnc(C#N)c(Cl)c2)[C@H](OC(C)=O)[C@@H](n2cc(C3(Cl)CSC=N3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H22Cl2N6O7S2/c1-11(32)35-8-17-20(36-12(2)33)19(31-7-18(29-30-31)23(25)9-39-10-28-23)21(37-13(3)34)22(38-17)40-14-4-15(24)16(5-26)27-6-14/h4,6-7,10,17,19-22H,8-9H2,1-3H3/t17-,19+,20+,21-,22-,23?/m1/s1 |
| InChIKey | VZTGDEUHJOKUFQ-IIIVKNBZSA-N |
| XLogP | 2.85 |
| TPSA | 167.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|