C21H22Cl2N4O8S — CID 155267814
[3,5-diacetyloxy-4-(4-carbamoyltriazol-1-yl)-6-(3,4-dichlorophenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 155267814) has the molecular formula C21H22Cl2N4O8S and a molecular weight of 561.40 g/mol. Its IUPAC name is [3,5-diacetyloxy-4-(4-carbamoyltriazol-1-yl)-6-(3,4-dichlorophenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-4-(4-carbamoyltriazol-1-yl)-6-(3,4-dichlorophenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155267814 |
| Molecular Formula | C21H22Cl2N4O8S |
| Molecular Weight | 561.40 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | [3,5-diacetyloxy-4-(4-carbamoyltriazol-1-yl)-6-(3,4-dichlorophenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Sc2ccc(Cl)c(Cl)c2)C(OC(C)=O)C(n2cc(C(N)=O)nn2)C1OC(C)=O |
| InChI | InChI=1S/C21H22Cl2N4O8S/c1-9(28)32-8-16-18(33-10(2)29)17(27-7-15(20(24)31)25-26-27)19(34-11(3)30)21(35-16)36-12-4-5-13(22)14(23)6-12/h4-7,16-19,21H,8H2,1-3H3,(H2,24,31) |
| InChIKey | MKWLLJZGLKQPKJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 161.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|