C23H21Cl3N4O8S2 — CID 160768525
[(3R,5S,6R)-3,5-diacetyloxy-4-[4-(2-oxo-3H-1,3-thiazol-4-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxan-2-yl]methyl acetate (PubChem CID 160768525) has the molecular formula C23H21Cl3N4O8S2 and a molecular weight of 651.93 g/mol. Its IUPAC name is [(3R,5S,6R)-3,5-diacetyloxy-4-[4-(2-oxo-3H-1,3-thiazol-4-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6R)-3,5-diacetyloxy-4-[4-(2-oxo-3H-1,3-thiazol-4-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 160768525 |
| Molecular Formula | C23H21Cl3N4O8S2 |
| Molecular Weight | 651.93 g/mol |
| Exact Mass | 649.99 |
| IUPAC Name | [(3R,5S,6R)-3,5-diacetyloxy-4-[4-(2-oxo-3H-1,3-thiazol-4-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cc(Cl)c(Cl)c(Cl)c2)[C@@H](OC(C)=O)C(n2cc(-c3csc(=O)[nH]3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H21Cl3N4O8S2/c1-9(31)35-7-17-20(36-10(2)32)19(30-6-15(28-29-30)16-8-39-23(34)27-16)21(37-11(3)33)22(38-17)40-12-4-13(24)18(26)14(25)5-12/h4-6,8,17,19-22H,7H2,1-3H3,(H,27,34)/t17?,19?,20-,21-,22+/m0/s1 |
| InChIKey | RYZUCJDBGQWDBP-JYACULSFSA-N |
| XLogP | 4.14 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.93 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|