C23H22Cl2N4O7S2 — CID 139328227
[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-(2,5-dichlorophenyl)sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 139328227) has the molecular formula C23H22Cl2N4O7S2 and a molecular weight of 601.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-(2,5-dichlorophenyl)sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-(2,5-dichlorophenyl)sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139328227 |
| Molecular Formula | C23H22Cl2N4O7S2 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 600.03 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-6-(2,5-dichlorophenyl)sulfanyl-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2cc(Cl)ccc2Cl)[C@H](OC(C)=O)[C@@H](n2cc(-c3nccs3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H22Cl2N4O7S2/c1-11(30)33-10-17-20(34-12(2)31)19(29-9-16(27-28-29)22-26-6-7-37-22)21(35-13(3)32)23(36-17)38-18-8-14(24)4-5-15(18)25/h4-9,17,19-21,23H,10H2,1-3H3/t17-,19+,20+,21-,23-/m1/s1 |
| InChIKey | JBJFGDVNXJHUGN-XSEKTIEYSA-N |
| XLogP | 4.19 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|