C25H22F3N5O9S — CID 145128996
[(3R,6R)-3,5-diacetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 145128996) has the molecular formula C25H22F3N5O9S and a molecular weight of 625.54 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145128996 |
| Molecular Formula | C25H22F3N5O9S |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2ccnc([N+](=O)[O-])c2)C(OC(C)=O)C(n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H22F3N5O9S/c1-11(34)39-10-19-23(40-12(2)35)22(32-9-18(30-31-32)14-6-16(26)21(28)17(27)7-14)24(41-13(3)36)25(42-19)43-15-4-5-29-20(8-15)33(37)38/h4-9,19,22-25H,10H2,1-3H3/t19?,22?,23-,24?,25+/m0/s1 |
| InChIKey | XQIGMJGUNNXDOL-MSOOMEKNSA-N |
| XLogP | 3.15 |
| TPSA | 174.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|