C21H22F3N3O7S — CID 172802931
2-[(2R,3R,4S,5R,6S)-2-(acetyloxymethyl)-5-(carboxymethyl)-6-methylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]acetic acid (PubChem CID 172802931) has the molecular formula C21H22F3N3O7S and a molecular weight of 517.48 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6S)-2-(acetyloxymethyl)-5-(carboxymethyl)-6-methylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S,5R,6S)-2-(acetyloxymethyl)-5-(carboxymethyl)-6-methylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 172802931 |
| Molecular Formula | C21H22F3N3O7S |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6S)-2-(acetyloxymethyl)-5-(carboxymethyl)-6-methylsulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]acetic acid |
| SMILES | CS[C@@H]1O[C@@H](COC(C)=O)[C@H](CC(=O)O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1CC(=O)O |
| InChI | InChI=1S/C21H22F3N3O7S/c1-9(28)33-8-16-11(5-17(29)30)20(12(6-18(31)32)21(34-16)35-2)27-7-15(25-26-27)10-3-13(22)19(24)14(23)4-10/h3-4,7,11-12,16,20-21H,5-6,8H2,1-2H3,(H,29,30)(H,31,32)/t11-,12+,16-,20-,21-/m0/s1 |
| InChIKey | RCQCRBOFTZLDJV-ZDNYHJPXSA-N |
| XLogP | 2.74 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|