C22H23BrF3N3O8 — CID 166803606
ethyl 2-[5-acetyloxy-6-(acetyloxymethyl)-2-bromo-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetate (PubChem CID 166803606) has the molecular formula C22H23BrF3N3O8 and a molecular weight of 594.34 g/mol. Its IUPAC name is ethyl 2-[5-acetyloxy-6-(acetyloxymethyl)-2-bromo-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetate.
| Compound Name | ethyl 2-[5-acetyloxy-6-(acetyloxymethyl)-2-bromo-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 166803606 |
| Molecular Formula | C22H23BrF3N3O8 |
| Molecular Weight | 594.34 g/mol |
| Exact Mass | 593.06 |
| IUPAC Name | ethyl 2-[5-acetyloxy-6-(acetyloxymethyl)-2-bromo-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl]oxyacetate |
| SMILES | CCOC(=O)COC1C(Br)OC(COC(C)=O)C(OC(C)=O)C1n1cc(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C22H23BrF3N3O8/c1-4-33-17(32)9-35-21-19(20(36-11(3)31)16(37-22(21)23)8-34-10(2)30)29-7-15(27-28-29)12-5-13(24)18(26)14(25)6-12/h5-7,16,19-22H,4,8-9H2,1-3H3 |
| InChIKey | LACUNXWKGAVNHM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 128.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|