C18H17BrF3N3O6 — CID 138516424
[(2R,3R,4R,5R,6R)-3-acetyloxy-6-bromo-5-hydroxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 138516424) has the molecular formula C18H17BrF3N3O6 and a molecular weight of 508.25 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3-acetyloxy-6-bromo-5-hydroxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3-acetyloxy-6-bromo-5-hydroxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 138516424 |
| Molecular Formula | C18H17BrF3N3O6 |
| Molecular Weight | 508.25 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3-acetyloxy-6-bromo-5-hydroxy-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Br)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H17BrF3N3O6/c1-7(26)29-6-13-17(30-8(2)27)15(16(28)18(19)31-13)25-5-12(23-24-25)9-3-10(20)14(22)11(21)4-9/h3-5,13,15-18,28H,6H2,1-2H3/t13-,15-,16-,17+,18+/m1/s1 |
| InChIKey | IMBAMHJRHBBLGL-XABWRGDLSA-N |
| XLogP | 1.88 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|