C26H28F5N3O7S — CID 122468066
[(3R,4S,6R)-3,5-diacetyloxy-6-(3,3-difluorocyclohexyl)sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 122468066) has the molecular formula C26H28F5N3O7S and a molecular weight of 621.58 g/mol. Its IUPAC name is [(3R,4S,6R)-3,5-diacetyloxy-6-(3,3-difluorocyclohexyl)sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-3,5-diacetyloxy-6-(3,3-difluorocyclohexyl)sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122468066 |
| Molecular Formula | C26H28F5N3O7S |
| Molecular Weight | 621.58 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | [(3R,4S,6R)-3,5-diacetyloxy-6-(3,3-difluorocyclohexyl)sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](SC2CCCC(F)(F)C2)C(OC(C)=O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H28F5N3O7S/c1-12(35)38-11-20-23(39-13(2)36)22(34-10-19(32-33-34)15-7-17(27)21(29)18(28)8-15)24(40-14(3)37)25(41-20)42-16-5-4-6-26(30,31)9-16/h7-8,10,16,20,22-25H,4-6,9,11H2,1-3H3/t16?,20?,22-,23-,24?,25+/m0/s1 |
| InChIKey | PUBUNKJJWIWZLX-LUTMSHDJSA-N |
| XLogP | 4.37 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|