C21H22F3N3O7 — CID 158212195
[(3R,4R,6S)-3,6-diacetyloxy-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 158212195) has the molecular formula C21H22F3N3O7 and a molecular weight of 485.42 g/mol. Its IUPAC name is [(3R,4R,6S)-3,6-diacetyloxy-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6S)-3,6-diacetyloxy-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 158212195 |
| Molecular Formula | C21H22F3N3O7 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | [(3R,4R,6S)-3,6-diacetyloxy-5-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC(C)=O)C(C)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H22F3N3O7/c1-9-19(27-7-16(25-26-27)13-5-14(22)18(24)15(23)6-13)20(32-11(3)29)17(8-31-10(2)28)34-21(9)33-12(4)30/h5-7,9,17,19-21H,8H2,1-4H3/t9?,17?,19-,20+,21-/m1/s1 |
| InChIKey | GCFFGGPQOXPVSF-HQJUKCBESA-N |
| XLogP | 2.32 |
| TPSA | 118.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|