C23H20F3N5O7S — CID 153284659
[(3R,4R,6R)-3-acetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 153284659) has the molecular formula C23H20F3N5O7S and a molecular weight of 567.50 g/mol. Its IUPAC name is [(3R,4R,6R)-3-acetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,6R)-3-acetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 153284659 |
| Molecular Formula | C23H20F3N5O7S |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | [(3R,4R,6R)-3-acetyloxy-6-[(2-nitro-4-pyridinyl)sulfanyl]-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2ccnc([N+](=O)[O-])c2)C[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H20F3N5O7S/c1-11(32)36-10-19-23(37-12(2)33)18(8-21(38-19)39-14-3-4-27-20(7-14)31(34)35)30-9-17(28-29-30)13-5-15(24)22(26)16(25)6-13/h3-7,9,18-19,21,23H,8,10H2,1-2H3/t18-,19?,21-,23-/m1/s1 |
| InChIKey | BVSJSOFDQSCRBZ-BHAPBFLFSA-N |
| XLogP | 3.61 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|