C24H29Cl2N3O8S — CID 145128977
[(3R,6R)-3,5-diacetyloxy-6-(3,4-dichlorophenyl)sulfanyl-4-[4-(1-hydroxybutyl)triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 145128977) has the molecular formula C24H29Cl2N3O8S and a molecular weight of 590.48 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-6-(3,4-dichlorophenyl)sulfanyl-4-[4-(1-hydroxybutyl)triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-6-(3,4-dichlorophenyl)sulfanyl-4-[4-(1-hydroxybutyl)triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 145128977 |
| Molecular Formula | C24H29Cl2N3O8S |
| Molecular Weight | 590.48 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-6-(3,4-dichlorophenyl)sulfanyl-4-[4-(1-hydroxybutyl)triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CCCC(O)c1cn(C2C(OC(C)=O)[C@@H](Sc3ccc(Cl)c(Cl)c3)OC(COC(C)=O)[C@@H]2OC(C)=O)nn1 |
| InChI | InChI=1S/C24H29Cl2N3O8S/c1-5-6-19(33)18-10-29(28-27-18)21-22(35-13(3)31)20(11-34-12(2)30)37-24(23(21)36-14(4)32)38-15-7-8-16(25)17(26)9-15/h7-10,19-24,33H,5-6,11H2,1-4H3/t19?,20?,21?,22-,23?,24+/m0/s1 |
| InChIKey | HIYWSRVFIIPQRV-KBCBTQMOSA-N |
| XLogP | 3.90 |
| TPSA | 139.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|