C19H17Cl2F3N4O5S2 — CID 166587092
4-[1-[(2R,4S,5R)-2-(3,4-dichlorophenyl)sulfanyl-5-hydroxy-6-(hydroxymethyl)-3-(2,2,2-trifluoroethoxy)oxan-4-yl]triazol-4-yl]-3H-1,3-thiazol-2-one (PubChem CID 166587092) has the molecular formula C19H17Cl2F3N4O5S2 and a molecular weight of 573.40 g/mol. Its IUPAC name is 4-[1-[(2R,4S,5R)-2-(3,4-dichlorophenyl)sulfanyl-5-hydroxy-6-(hydroxymethyl)-3-(2,2,2-trifluoroethoxy)oxan-4-yl]triazol-4-yl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[1-[(2R,4S,5R)-2-(3,4-dichlorophenyl)sulfanyl-5-hydroxy-6-(hydroxymethyl)-3-(2,2,2-trifluoroethoxy)oxan-4-yl]triazol-4-yl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 166587092 |
| Molecular Formula | C19H17Cl2F3N4O5S2 |
| Molecular Weight | 573.40 g/mol |
| Exact Mass | 572.00 |
| IUPAC Name | 4-[1-[(2R,4S,5R)-2-(3,4-dichlorophenyl)sulfanyl-5-hydroxy-6-(hydroxymethyl)-3-(2,2,2-trifluoroethoxy)oxan-4-yl]triazol-4-yl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(-c2cn([C@@H]3C(OCC(F)(F)F)[C@@H](Sc4ccc(Cl)c(Cl)c4)OC(CO)[C@@H]3O)nn2)cs1 |
| InChI | InChI=1S/C19H17Cl2F3N4O5S2/c20-9-2-1-8(3-10(9)21)35-17-16(32-7-19(22,23)24)14(15(30)13(5-29)33-17)28-4-11(26-27-28)12-6-34-18(31)25-12/h1-4,6,13-17,29-30H,5,7H2,(H,25,31)/t13?,14-,15-,16?,17+/m0/s1 |
| InChIKey | LQNYXBSIAWDVOU-LAYQYYCJSA-N |
| XLogP | 3.36 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |