C18H17Cl2N3O4S2 — CID 139328189
(2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-(4-thiophen-3-yltriazol-1-yl)oxane-3,5-diol (PubChem CID 139328189) has the molecular formula C18H17Cl2N3O4S2 and a molecular weight of 474.39 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-(4-thiophen-3-yltriazol-1-yl)oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-(4-thiophen-3-yltriazol-1-yl)oxane-3,5-diol |
|---|---|
| PubChem CID | 139328189 |
| Molecular Formula | C18H17Cl2N3O4S2 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(3,4-dichlorophenyl)sulfanyl-6-(hydroxymethyl)-4-(4-thiophen-3-yltriazol-1-yl)oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@H](Sc2ccc(Cl)c(Cl)c2)[C@H](O)[C@@H](n2cc(-c3ccsc3)nn2)[C@H]1O |
| InChI | InChI=1S/C18H17Cl2N3O4S2/c19-11-2-1-10(5-12(11)20)29-18-17(26)15(16(25)14(7-24)27-18)23-6-13(21-22-23)9-3-4-28-8-9/h1-6,8,14-18,24-26H,7H2/t14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | YPLBYIHMHBFKDC-DISONHOPSA-N |
| XLogP | 3.09 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |