C17H15Cl2FN4O4S2 — CID 139328253
(2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol (PubChem CID 139328253) has the molecular formula C17H15Cl2FN4O4S2 and a molecular weight of 493.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 139328253 |
| Molecular Formula | C17H15Cl2FN4O4S2 |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@H](Sc2cc(Cl)c(F)c(Cl)c2)[C@H](O)[C@@H](n2cc(-c3cscn3)nn2)[C@H]1O |
| InChI | InChI=1S/C17H15Cl2FN4O4S2/c18-8-1-7(2-9(19)13(8)20)30-17-16(27)14(15(26)12(4-25)28-17)24-3-10(22-23-24)11-5-29-6-21-11/h1-3,5-6,12,14-17,25-27H,4H2/t12-,14+,15+,16-,17-/m1/s1 |
| InChIKey | PUBCIQPVAYGFEN-UVLCOCDESA-N |
| XLogP | 2.62 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|