C17H16Cl2FN5O4S2 — CID 177374067
(2R,3R,4S,5R,6R)-4-[4-(4-amino-1,3-thiazol-2-yl)triazol-1-yl]-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 177374067) has the molecular formula C17H16Cl2FN5O4S2 and a molecular weight of 508.38 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(4-amino-1,3-thiazol-2-yl)triazol-1-yl]-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(4-amino-1,3-thiazol-2-yl)triazol-1-yl]-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 177374067 |
| Molecular Formula | C17H16Cl2FN5O4S2 |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(4-amino-1,3-thiazol-2-yl)triazol-1-yl]-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | Nc1csc(-c2cn([C@@H]3[C@@H](O)[C@@H](Sc4cc(Cl)c(F)c(Cl)c4)O[C@H](CO)[C@@H]3O)nn2)n1 |
| InChI | InChI=1S/C17H16Cl2FN5O4S2/c18-7-1-6(2-8(19)12(7)20)31-17-15(28)13(14(27)10(4-26)29-17)25-3-9(23-24-25)16-22-11(21)5-30-16/h1-3,5,10,13-15,17,26-28H,4,21H2/t10-,13+,14+,15-,17-/m1/s1 |
| InChIKey | PHRCCAYLOPTYOY-OWKNBALPSA-N |
| XLogP | 2.20 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|