C16H14Cl3N5O4S2 — CID 152812318
(3R,6R)-2-(hydroxymethyl)-4-[4-(1,3,4-thiadiazol-2-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxane-3,5-diol (PubChem CID 152812318) has the molecular formula C16H14Cl3N5O4S2 and a molecular weight of 510.81 g/mol. Its IUPAC name is (3R,6R)-2-(hydroxymethyl)-4-[4-(1,3,4-thiadiazol-2-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxane-3,5-diol.
| Compound Name | (3R,6R)-2-(hydroxymethyl)-4-[4-(1,3,4-thiadiazol-2-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 152812318 |
| Molecular Formula | C16H14Cl3N5O4S2 |
| Molecular Weight | 510.81 g/mol |
| Exact Mass | 508.96 |
| IUPAC Name | (3R,6R)-2-(hydroxymethyl)-4-[4-(1,3,4-thiadiazol-2-yl)triazol-1-yl]-6-(3,4,5-trichlorophenyl)sulfanyloxane-3,5-diol |
| SMILES | OCC1O[C@H](Sc2cc(Cl)c(Cl)c(Cl)c2)C(O)C(n2cc(-c3nncs3)nn2)[C@H]1O |
| InChI | InChI=1S/C16H14Cl3N5O4S2/c17-7-1-6(2-8(18)11(7)19)30-16-14(27)12(13(26)10(4-25)28-16)24-3-9(21-23-24)15-22-20-5-29-15/h1-3,5,10,12-14,16,25-27H,4H2/t10?,12?,13-,14?,16+/m0/s1 |
| InChIKey | SRKDCCXTCUVMEY-IGXCMMJKSA-N |
| XLogP | 2.53 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|