C18H17Cl2FN4O5S2 — CID 177374064
(2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(2-methoxy-1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol (PubChem CID 177374064) has the molecular formula C18H17Cl2FN4O5S2 and a molecular weight of 523.40 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(2-methoxy-1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(2-methoxy-1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 177374064 |
| Molecular Formula | C18H17Cl2FN4O5S2 |
| Molecular Weight | 523.40 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(3,5-dichloro-4-fluorophenyl)sulfanyl-6-(hydroxymethyl)-4-[4-(2-methoxy-1,3-thiazol-4-yl)triazol-1-yl]oxane-3,5-diol |
| SMILES | COc1nc(-c2cn([C@@H]3[C@@H](O)[C@@H](Sc4cc(Cl)c(F)c(Cl)c4)O[C@H](CO)[C@@H]3O)nn2)cs1 |
| InChI | InChI=1S/C18H17Cl2FN4O5S2/c1-29-18-22-11(6-31-18)10-4-25(24-23-10)14-15(27)12(5-26)30-17(16(14)28)32-7-2-8(19)13(21)9(20)3-7/h2-4,6,12,14-17,26-28H,5H2,1H3/t12-,14+,15+,16-,17-/m1/s1 |
| InChIKey | FRVIMUAGHUSYFN-UVLCOCDESA-N |
| XLogP | 2.63 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|