C18H19ClN4O5S — CID 167602219
[(3R,5S,6R)-3-acetyloxy-4-azido-6-(3-chloro-4-cyanophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate (PubChem CID 167602219) has the molecular formula C18H19ClN4O5S and a molecular weight of 438.89 g/mol. Its IUPAC name is [(3R,5S,6R)-3-acetyloxy-4-azido-6-(3-chloro-4-cyanophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5S,6R)-3-acetyloxy-4-azido-6-(3-chloro-4-cyanophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167602219 |
| Molecular Formula | C18H19ClN4O5S |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | [(3R,5S,6R)-3-acetyloxy-4-azido-6-(3-chloro-4-cyanophenyl)sulfanyl-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2ccc(C#N)c(Cl)c2)[C@@H](C)C(N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19ClN4O5S/c1-9-16(22-23-21)17(27-11(3)25)15(8-26-10(2)24)28-18(9)29-13-5-4-12(7-20)14(19)6-13/h4-6,9,15-18H,8H2,1-3H3/t9-,15?,16?,17-,18+/m0/s1 |
| InChIKey | JWYTXYOSYYUGHC-YOJFPKMKSA-N |
| XLogP | 3.84 |
| TPSA | 134.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|