C18H18BrN5O7S — CID 139581445
[(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(4-bromo-5-cyano-2-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 139581445) has the molecular formula C18H18BrN5O7S and a molecular weight of 528.34 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(4-bromo-5-cyano-2-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(4-bromo-5-cyano-2-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139581445 |
| Molecular Formula | C18H18BrN5O7S |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-diacetyloxy-4-azido-6-[(4-bromo-5-cyano-2-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Sc2cc(Br)c(C#N)cn2)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H18BrN5O7S/c1-8(25)28-7-13-16(29-9(2)26)15(23-24-21)17(30-10(3)27)18(31-13)32-14-4-12(19)11(5-20)6-22-14/h4,6,13,15-18H,7H2,1-3H3/t13-,15+,16+,17-,18-/m1/s1 |
| InChIKey | ZTUFPMRSUJQJLZ-PLLDYVMSSA-N |
| XLogP | 2.64 |
| TPSA | 173.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|