C30H38BrClN8O6S2 — CID 167568582
[(3R,4S,6R)-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate;[(3R,4S,6R)-4-azido-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate (PubChem CID 167568582) has the molecular formula C30H38BrClN8O6S2 and a molecular weight of 786.17 g/mol. Its IUPAC name is [(3R,4S,6R)-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate;[(3R,4S,6R)-4-azido-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6R)-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate;[(3R,4S,6R)-4-azido-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 167568582 |
| Molecular Formula | C30H38BrClN8O6S2 |
| Molecular Weight | 786.17 g/mol |
| Exact Mass | 784.12 |
| IUPAC Name | [(3R,4S,6R)-4-azido-6-[(5-bromo-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate;[(3R,4S,6R)-4-azido-6-[(5-chloro-3-pyridinyl)sulfanyl]-3,5-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](Sc2cncc(Br)c2)C(C)[C@@H](N=[N+]=[N-])[C@H]1C.CC(=O)OCC1O[C@H](Sc2cncc(Cl)c2)C(C)[C@@H](N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C15H19BrN4O3S.C15H19ClN4O3S/c2*1-8-13(7-22-10(3)21)23-15(9(2)14(8)19-20-17)24-12-4-11(16)5-18-6-12/h2*4-6,8-9,13-15H,7H2,1-3H3/t2*8-,9?,13?,14-,15+/m00/s1 |
| InChIKey | FPGNHISJQGXKLU-DGMVYYDYSA-N |
| XLogP | 8.24 |
| TPSA | 194.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.17 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|