C21H27BrN4O8S — CID 134176844
[3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 134176844) has the molecular formula C21H27BrN4O8S and a molecular weight of 575.44 g/mol. Its IUPAC name is [3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134176844 |
| Molecular Formula | C21H27BrN4O8S |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | [3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Sc2cncc(Br)c2)C(OC(C)=O)C(N(N)/C=C(\N)C(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H27BrN4O8S/c1-10(27)16(23)8-26(24)18-19(32-12(3)29)17(9-31-11(2)28)34-21(20(18)33-13(4)30)35-15-5-14(22)6-25-7-15/h5-8,17-21H,9,23-24H2,1-4H3/b16-8- |
| InChIKey | GPBVVXXGNVUNBY-PXNMLYILSA-N |
| XLogP | 1.02 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|