C23H35BrN4O8S — CID 145440146
[3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-hydroxybut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate;ethane (PubChem CID 145440146) has the molecular formula C23H35BrN4O8S and a molecular weight of 607.52 g/mol. Its IUPAC name is [3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-hydroxybut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate;ethane.
| Compound Name | [3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-hydroxybut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate;ethane |
|---|---|
| PubChem CID | 145440146 |
| Molecular Formula | C23H35BrN4O8S |
| Molecular Weight | 607.52 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | [3,5-diacetyloxy-4-[amino-[(Z)-2-amino-3-hydroxybut-1-enyl]amino]-6-[(5-bromo-3-pyridinyl)sulfanyl]oxan-2-yl]methyl acetate;ethane |
| SMILES | CC.CC(=O)OCC1OC(Sc2cncc(Br)c2)C(OC(C)=O)C(N(N)/C=C(\N)C(C)O)C1OC(C)=O |
| InChI | InChI=1S/C21H29BrN4O8S.C2H6/c1-10(27)16(23)8-26(24)18-19(32-12(3)29)17(9-31-11(2)28)34-21(20(18)33-13(4)30)35-15-5-14(22)6-25-7-15;1-2/h5-8,10,17-21,27H,9,23-24H2,1-4H3;1-2H3/b16-8-; |
| InChIKey | XHNSVBUCBUMPAB-SQIOZQJDSA-N |
| XLogP | 1.84 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|