C19H22BrNO7S — CID 148701273
[(3R,6R)-3,5-diacetyloxy-6-(3-bromophenyl)sulfanyl-4-(methylideneamino)oxan-2-yl]methyl acetate (PubChem CID 148701273) has the molecular formula C19H22BrNO7S and a molecular weight of 488.36 g/mol. Its IUPAC name is [(3R,6R)-3,5-diacetyloxy-6-(3-bromophenyl)sulfanyl-4-(methylideneamino)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6R)-3,5-diacetyloxy-6-(3-bromophenyl)sulfanyl-4-(methylideneamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 148701273 |
| Molecular Formula | C19H22BrNO7S |
| Molecular Weight | 488.36 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | [(3R,6R)-3,5-diacetyloxy-6-(3-bromophenyl)sulfanyl-4-(methylideneamino)oxan-2-yl]methyl acetate |
| SMILES | C=NC1C(OC(C)=O)[C@@H](Sc2cccc(Br)c2)OC(COC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H22BrNO7S/c1-10(22)25-9-15-17(26-11(2)23)16(21-4)18(27-12(3)24)19(28-15)29-14-7-5-6-13(20)8-14/h5-8,15-19H,4,9H2,1-3H3/t15?,16?,17-,18?,19+/m0/s1 |
| InChIKey | NVKHCNTYJXJEJA-RFFDILEWSA-N |
| XLogP | 2.76 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|