C17H19NO5S — CID 176521899
[(3aR,4R,6R,6aR)-4-(1,3-benzothiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 176521899) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(1,3-benzothiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(1,3-benzothiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 176521899 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(1,3-benzothiazol-2-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2nc3ccccc3s2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H19NO5S/c1-9(19)20-8-11-13-14(23-17(2,3)22-13)15(21-11)16-18-10-6-4-5-7-12(10)24-16/h4-7,11,13-15H,8H2,1-3H3/t11-,13-,14-,15-/m1/s1 |
| InChIKey | ZWNYYAOAQDKVIE-NMFUWQPSSA-N |
| XLogP | 2.82 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |