C31H38O9S2 — CID 11763467
[(4R,5R)-5-[3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2,2-bis(phenylsulfanyl)propanoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 11763467) has the molecular formula C31H38O9S2 and a molecular weight of 618.77 g/mol. Its IUPAC name is [(4R,5R)-5-[3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2,2-bis(phenylsulfanyl)propanoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl acetate.
| Compound Name | [(4R,5R)-5-[3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2,2-bis(phenylsulfanyl)propanoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 11763467 |
| Molecular Formula | C31H38O9S2 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | [(4R,5R)-5-[3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2,2-bis(phenylsulfanyl)propanoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](CC(Sc2ccccc2)(Sc2ccccc2)C(=O)[C@@H]2OC(C)(C)O[C@@H]2COC(C)=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C31H38O9S2/c1-19(32)35-18-23-25(39-29(2,3)37-23)27(33)31(41-20-13-9-7-10-14-20,42-21-15-11-8-12-16-21)17-22-24-26(28(34-6)36-22)40-30(4,5)38-24/h7-16,22-26,28H,17-18H2,1-6H3/t22-,23-,24-,25-,26-,28-/m1/s1 |
| InChIKey | UCICVRDLLBEYCZ-MSJONNDVSA-N |
| XLogP | 5.20 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|