C12H22N2O5 — CID 174154685
[(3aR,7S,7aR)-7-amino-6-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate (PubChem CID 174154685) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is [(3aR,7S,7aR)-7-amino-6-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate.
| Compound Name | [(3aR,7S,7aR)-7-amino-6-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
|---|---|
| PubChem CID | 174154685 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | [(3aR,7S,7aR)-7-amino-6-(aminomethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(CN)[C@H](N)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H22N2O5/c1-6(15)16-5-8-10-11(19-12(2,3)18-10)9(14)7(4-13)17-8/h7-11H,4-5,13-14H2,1-3H3/t7?,8?,9-,10-,11+/m0/s1 |
| InChIKey | SLLMVCQEATVOJG-KQBLQLDCSA-N |
| XLogP | -0.88 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |