C14H21NO6 — CID 167524351
[(1R,2R,6R,7R,9S)-4,4-dimethyl-12-oxo-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecan-7-yl]methyl acetate (PubChem CID 167524351) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is [(1R,2R,6R,7R,9S)-4,4-dimethyl-12-oxo-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecan-7-yl]methyl acetate.
| Compound Name | [(1R,2R,6R,7R,9S)-4,4-dimethyl-12-oxo-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecan-7-yl]methyl acetate |
|---|---|
| PubChem CID | 167524351 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(1R,2R,6R,7R,9S)-4,4-dimethyl-12-oxo-3,5,8-trioxa-13-azatricyclo[7.4.0.02,6]tridecan-7-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2CCC(=O)N[C@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H21NO6/c1-7(16)18-6-9-12-13(21-14(2,3)20-12)11-8(19-9)4-5-10(17)15-11/h8-9,11-13H,4-6H2,1-3H3,(H,15,17)/t8-,9+,11+,12-,13+/m0/s1 |
| InChIKey | JQKWBYLUYRNJFL-NELYUFSOSA-N |
| XLogP | 0.12 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |