C14H19NO8 — CID 122391857
[(3aR,5R,6S,7R,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrol-5-yl]methyl acetate (PubChem CID 122391857) has the molecular formula C14H19NO8 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(3aR,5R,6S,7R,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrol-5-yl]methyl acetate.
| Compound Name | [(3aR,5R,6S,7R,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 122391857 |
| Molecular Formula | C14H19NO8 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [(3aR,5R,6S,7R,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydro-1H-pyrano[3,2-b]pyrrol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2CC(=O)N[C@@H]2[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H19NO8/c1-6(16)20-5-10-13(21-7(2)17)14(22-8(3)18)12-9(23-10)4-11(19)15-12/h9-10,12-14H,4-5H2,1-3H3,(H,15,19)/t9-,10-,12+,13-,14-/m1/s1 |
| InChIKey | GBDRPDNWTIGKGN-IGJDLRFWSA-N |
| XLogP | -0.93 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|