C17H23NO10 — CID 101422427
[(2R,3R,4R,4aS,7S,8aS)-3,4,7-triacetyloxy-6-oxo-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-b]pyridin-2-yl]methyl acetate (PubChem CID 101422427) has the molecular formula C17H23NO10 and a molecular weight of 401.37 g/mol. Its IUPAC name is [(2R,3R,4R,4aS,7S,8aS)-3,4,7-triacetyloxy-6-oxo-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-b]pyridin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,4aS,7S,8aS)-3,4,7-triacetyloxy-6-oxo-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-b]pyridin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101422427 |
| Molecular Formula | C17H23NO10 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [(2R,3R,4R,4aS,7S,8aS)-3,4,7-triacetyloxy-6-oxo-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-b]pyridin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H]2C[C@H](OC(C)=O)C(=O)N[C@@H]2[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H23NO10/c1-7(19)24-6-13-15(26-9(3)21)16(27-10(4)22)14-11(28-13)5-12(17(23)18-14)25-8(2)20/h11-16H,5-6H2,1-4H3,(H,18,23)/t11-,12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | ZHSUHNKSOPRHKA-KXKVQDCLSA-N |
| XLogP | -1.00 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|