C14H19N3O7 — CID 71749612
methyl 1-[(3aR,6R,6aS)-6-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxylate (PubChem CID 71749612) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is methyl 1-[(3aR,6R,6aS)-6-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-[(3aR,6R,6aS)-6-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 71749612 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | methyl 1-[(3aR,6R,6aS)-6-(acetyloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(C2O[C@H](COC(C)=O)[C@@H]3OC(C)(C)O[C@@H]23)n1 |
| InChI | InChI=1S/C14H19N3O7/c1-7(18)21-5-8-9-10(24-14(2,3)23-9)12(22-8)17-6-15-11(16-17)13(19)20-4/h6,8-10,12H,5H2,1-4H3/t8-,9+,10-,12?/m1/s1 |
| InChIKey | QEPMHZGGDGDYIX-SMRSKGNSSA-N |
| XLogP | 0.05 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |