C17H21N5O7 — CID 122130807
[(3aR,4R,6R,6aR)-4-(2-acetamido-6-oxo-5H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 122130807) has the molecular formula C17H21N5O7 and a molecular weight of 407.38 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-(2-acetamido-6-oxo-5H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aR,4R,6R,6aR)-4-(2-acetamido-6-oxo-5H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 122130807 |
| Molecular Formula | C17H21N5O7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-(2-acetamido-6-oxo-5H-purin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)NC1=NC(=O)C2N=CN([C@@H]3O[C@H](COC(C)=O)[C@H]4OC(C)(C)O[C@H]43)C2=N1 |
| InChI | InChI=1S/C17H21N5O7/c1-7(23)19-16-20-13-10(14(25)21-16)18-6-22(13)15-12-11(28-17(3,4)29-12)9(27-15)5-26-8(2)24/h6,9-12,15H,5H2,1-4H3,(H,19,21,23,25)/t9-,10?,11-,12-,15-/m1/s1 |
| InChIKey | XUNAEVVIKXFFMT-SCEMBWEMSA-N |
| XLogP | -1.06 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |