C15H24O8S — CID 22974878
[(2S,3R,4S,5R,6S)-3,5-diacetyloxy-6-ethylsulfanyl-4-methoxyoxan-2-yl]methyl acetate (PubChem CID 22974878) has the molecular formula C15H24O8S and a molecular weight of 364.42 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6S)-3,5-diacetyloxy-6-ethylsulfanyl-4-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6S)-3,5-diacetyloxy-6-ethylsulfanyl-4-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 22974878 |
| Molecular Formula | C15H24O8S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [(2S,3R,4S,5R,6S)-3,5-diacetyloxy-6-ethylsulfanyl-4-methoxyoxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O8S/c1-6-24-15-14(22-10(4)18)13(19-5)12(21-9(3)17)11(23-15)7-20-8(2)16/h11-15H,6-7H2,1-5H3/t11-,12+,13-,14+,15-/m0/s1 |
| InChIKey | ZKLWIWOKAYXFBA-ZQNQSHIBSA-N |
| XLogP | 0.91 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|