C14H24O7 — CID 87093648
[(5R,6S,6aR)-6-butylperoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate (PubChem CID 87093648) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(5R,6S,6aR)-6-butylperoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate.
| Compound Name | [(5R,6S,6aR)-6-butylperoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 87093648 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(5R,6S,6aR)-6-butylperoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl acetate |
| SMILES | CCCCOO[C@H]1[C@@H](COC(C)=O)OC2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H24O7/c1-5-6-7-17-21-11-10(8-16-9(2)15)18-13-12(11)19-14(3,4)20-13/h10-13H,5-8H2,1-4H3/t10-,11+,12-,13?/m1/s1 |
| InChIKey | TUIUDGVXXRJDEQ-DAAZQVBGSA-N |
| XLogP | 1.54 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|