C19H18F8O5 — CID 134879769
1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,3,4,4,5,5,5-octafluoropentan-1-one (PubChem CID 134879769) has the molecular formula C19H18F8O5 and a molecular weight of 478.33 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,3,4,4,5,5,5-octafluoropentan-1-one.
| Compound Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,3,4,4,5,5,5-octafluoropentan-1-one |
|---|---|
| PubChem CID | 134879769 |
| Molecular Formula | C19H18F8O5 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,3,4,4,5,5,5-octafluoropentan-1-one |
| SMILES | CC1(C)O[C@H]2O[C@H](C(=O)C(F)C(F)(F)C(F)(F)C(F)(F)F)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H18F8O5/c1-16(2)31-13-12(29-8-9-6-4-3-5-7-9)11(30-15(13)32-16)10(28)14(20)17(21,22)18(23,24)19(25,26)27/h3-7,11-15H,8H2,1-2H3/t11-,12+,13-,14?,15-/m1/s1 |
| InChIKey | ZZSKKASVPMSRSF-VVYWCFLBSA-N |
| XLogP | 4.19 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|