C23H21F13O6 — CID 102317400
[(1R)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl] acetate (PubChem CID 102317400) has the molecular formula C23H21F13O6 and a molecular weight of 640.39 g/mol. Its IUPAC name is [(1R)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl] acetate.
| Compound Name | [(1R)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl] acetate |
|---|---|
| PubChem CID | 102317400 |
| Molecular Formula | C23H21F13O6 |
| Molecular Weight | 640.39 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | [(1R)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl] acetate |
| SMILES | CC(=O)O[C@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H21F13O6/c1-10(37)39-15(18(24,25)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)36)13-12(38-9-11-7-5-4-6-8-11)14-16(40-13)42-17(2,3)41-14/h4-8,12-16H,9H2,1-3H3/t12-,13-,14+,15+,16+/m0/s1 |
| InChIKey | LKFQSOPUWZQMLW-AALSBFMBSA-N |
| XLogP | 6.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.39 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|