C28H36O12 — CID 101364128
[(2S,3R,4S,5S)-5-[(S)-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-acetyloxymethyl]-3-acetyloxy-2-methoxy-6-methylideneoxan-4-yl] acetate (PubChem CID 101364128) has the molecular formula C28H36O12 and a molecular weight of 564.58 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-[(S)-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-acetyloxymethyl]-3-acetyloxy-2-methoxy-6-methylideneoxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5S)-5-[(S)-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-acetyloxymethyl]-3-acetyloxy-2-methoxy-6-methylideneoxan-4-yl] acetate |
|---|---|
| PubChem CID | 101364128 |
| Molecular Formula | C28H36O12 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(2S,3R,4S,5S)-5-[(S)-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-acetyloxymethyl]-3-acetyloxy-2-methoxy-6-methylideneoxan-4-yl] acetate |
| SMILES | C=C1O[C@H](OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1[C@H](OC(C)=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H36O12/c1-14-19(21(36-16(3)30)24(37-17(4)31)26(32-7)34-14)20(35-15(2)29)23-22(33-13-18-11-9-8-10-12-18)25-27(38-23)40-28(5,6)39-25/h8-12,19-27H,1,13H2,2-7H3/t19-,20-,21-,22-,23+,24+,25+,26-,27+/m0/s1 |
| InChIKey | NUZVFNFVBINWJU-RERPHQIASA-N |
| XLogP | 2.38 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|