C15H13N3O2 — CID 3087672
1H-pyrazol-4-ylmethyl N-naphthalen-1-ylcarbamate (PubChem CID 3087672) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 1H-pyrazol-4-ylmethyl N-naphthalen-1-ylcarbamate.
| Compound Name | 1H-pyrazol-4-ylmethyl N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 3087672 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1H-pyrazol-4-ylmethyl N-naphthalen-1-ylcarbamate |
| SMILES | O=C(Nc1cccc2ccccc12)OCc1cn[nH]c1 |
| InChI | InChI=1S/C15H13N3O2/c19-15(20-10-11-8-16-17-9-11)18-14-7-3-5-12-4-1-2-6-13(12)14/h1-9H,10H2,(H,16,17)(H,18,19) |
| InChIKey | XQCVCBPTVPMRNF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |