C28H26N2O4 — CID 146590877
2-(phenylmethoxycarbonylamino)ethyl N-(7-benzylnaphthalen-1-yl)carbamate (PubChem CID 146590877) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-(phenylmethoxycarbonylamino)ethyl N-(7-benzylnaphthalen-1-yl)carbamate.
| Compound Name | 2-(phenylmethoxycarbonylamino)ethyl N-(7-benzylnaphthalen-1-yl)carbamate |
|---|---|
| PubChem CID | 146590877 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-(phenylmethoxycarbonylamino)ethyl N-(7-benzylnaphthalen-1-yl)carbamate |
| SMILES | O=C(NCCOC(=O)Nc1cccc2ccc(Cc3ccccc3)cc12)OCc1ccccc1 |
| InChI | InChI=1S/C28H26N2O4/c31-27(34-20-22-10-5-2-6-11-22)29-16-17-33-28(32)30-26-13-7-12-24-15-14-23(19-25(24)26)18-21-8-3-1-4-9-21/h1-15,19H,16-18,20H2,(H,29,31)(H,30,32) |
| InChIKey | BQZWCJZPXDVWFX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|