C29H26N2O6 — CID 146590905
6-benzyl-4-[2-(phenylmethoxycarbonylamino)ethoxycarbonylamino]naphthalene-2-carboxylic acid (PubChem CID 146590905) has the molecular formula C29H26N2O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is 6-benzyl-4-[2-(phenylmethoxycarbonylamino)ethoxycarbonylamino]naphthalene-2-carboxylic acid.
| Compound Name | 6-benzyl-4-[2-(phenylmethoxycarbonylamino)ethoxycarbonylamino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 146590905 |
| Molecular Formula | C29H26N2O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 6-benzyl-4-[2-(phenylmethoxycarbonylamino)ethoxycarbonylamino]naphthalene-2-carboxylic acid |
| SMILES | O=C(NCCOC(=O)Nc1cc(C(=O)O)cc2ccc(Cc3ccccc3)cc12)OCc1ccccc1 |
| InChI | InChI=1S/C29H26N2O6/c32-27(33)24-17-23-12-11-22(15-20-7-3-1-4-8-20)16-25(23)26(18-24)31-29(35)36-14-13-30-28(34)37-19-21-9-5-2-6-10-21/h1-12,16-18H,13-15,19H2,(H,30,34)(H,31,35)(H,32,33) |
| InChIKey | VEFHXHDFPOPQPL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|