C16H23ClN3O3+ — CID 8711692
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium (PubChem CID 8711692) has the molecular formula C16H23ClN3O3+ and a molecular weight of 340.83 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
|---|---|
| PubChem CID | 8711692 |
| Molecular Formula | C16H23ClN3O3+ |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl]-methyl-(2-morpholin-4-yl-2-oxoethyl)azanium |
| SMILES | C[C@H](C(=O)Nc1ccc(Cl)cc1)[NH+](C)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H22ClN3O3/c1-12(16(22)18-14-5-3-13(17)4-6-14)19(2)11-15(21)20-7-9-23-10-8-20/h3-6,12H,7-11H2,1-2H3,(H,18,22)/p+1/t12-/m1/s1 |
| InChIKey | NHTUGGBUVRBKPY-GFCCVEGCSA-O |
| XLogP | 0.04 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |