C23H31N4O4+ — CID 8592727
[(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl]-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium (PubChem CID 8592727) has the molecular formula C23H31N4O4+ and a molecular weight of 427.53 g/mol. Its IUPAC name is [(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl]-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium.
| Compound Name | [(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl]-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8592727 |
| Molecular Formula | C23H31N4O4+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl]-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
| SMILES | COc1cccc(NC(=O)[C@@H](C)[NH+](C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C23H30N4O4/c1-17(23(29)25-19-5-4-6-21(15-19)30-3)26(2)16-22(28)24-18-7-9-20(10-8-18)27-11-13-31-14-12-27/h4-10,15,17H,11-14,16H2,1-3H3,(H,24,28)(H,25,29)/p+1/t17-/m1/s1 |
| InChIKey | IVMOHCSAFKVUQQ-QGZVFWFLSA-O |
| XLogP | 1.01 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|