C16H22ClN3O3 — CID 110348760
1-(4-chlorophenyl)-3-[(2S)-3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl]urea (PubChem CID 110348760) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2S)-3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2S)-3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 110348760 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2S)-3-methyl-1-morpholin-4-yl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccc(Cl)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H22ClN3O3/c1-11(2)14(15(21)20-7-9-23-10-8-20)19-16(22)18-13-5-3-12(17)4-6-13/h3-6,11,14H,7-10H2,1-2H3,(H2,18,19,22)/t14-/m0/s1 |
| InChIKey | QJYTYEFWGKDEGY-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |