About 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine
1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine (PubChem CID 157402715) has the molecular formula C22H26Cl2N4O4
and a molecular weight of 481.38 g/mol. Its IUPAC name is 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine.
Molecular Properties
| Compound Name | 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine |
| PubChem CID | 157402715 |
| Molecular Formula | C22H26Cl2N4O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine |
| SMILES | C1COCCN1.O=C(Nc1ccc(Cl)cc1)N1CCOCC1.O=C=Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClN2O2.C7H4ClNO.C4H9NO/c12-9-1-3-10(4-2-9)13-11(15)14-5-7-16-8-6-14;8-6-1-3-7(4-2-6)9-5-10;1-3-6-4-2-5-1/h1-4H,5-8H2,(H,13,15);1-4H;5H,1-4H2 |
| InChIKey | BNIXUQCNTACMLC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine?
The IUPAC name of 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine (CID 157402715) is 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine.
What is the SMILES notation for 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine?
The canonical SMILES for 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine is C1COCCN1.O=C(Nc1ccc(Cl)cc1)N1CCOCC1.O=C=Nc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine?
The InChIKey is BNIXUQCNTACMLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O2.C7H4ClNO.C4H9NO/c12-9-1-3-10(4-2-9)13-11(15)14-5-7-16-8-6-14;8-6-1-3-7(4-2-6)9-5-10;1-3-6-4-2-5-1/h1-4H,5-8H2,(H,13,15);1-4H;5H,1-4H2.
What are the key properties of 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine?
1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine has a molecular weight of 481.38 g/mol, XLogP of 4.12, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-isocyanatobenzene;N-(4-chlorophenyl)morpholine-4-carboxamide;morpholine is sourced from PubChem (CID 157402715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).