C22H25F3N4O4 — CID 42701145
1-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 42701145) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 42701145 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N(CCCN1CCOCC1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N4O4/c23-22(24,25)18-4-2-17(3-5-18)16-28(11-1-10-27-12-14-33-15-13-27)21(30)26-19-6-8-20(9-7-19)29(31)32/h2-9H,1,10-16H2,(H,26,30) |
| InChIKey | DZQQQCPDBMRJAD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|