C20H23F3N2O2S — CID 42701086
N-(3-morpholin-4-ylpropyl)-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 42701086) has the molecular formula C20H23F3N2O2S and a molecular weight of 412.48 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42701086 |
| Molecular Formula | C20H23F3N2O2S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(CCCN1CCOCC1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O2S/c21-20(22,23)17-6-4-16(5-7-17)15-25(19(26)18-3-1-14-28-18)9-2-8-24-10-12-27-13-11-24/h1,3-7,14H,2,8-13,15H2 |
| InChIKey | MYTVXTBIPYEOPP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |