C21H25Cl2N3O2 — CID 5011395
3-(4-chlorophenyl)-1-[(3-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea (PubChem CID 5011395) has the molecular formula C21H25Cl2N3O2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(3-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 3-(4-chlorophenyl)-1-[(3-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 5011395 |
| Molecular Formula | C21H25Cl2N3O2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(3-chlorophenyl)methyl]-1-(3-morpholin-4-ylpropyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)N(CCCN1CCOCC1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c22-18-5-7-20(8-6-18)24-21(27)26(16-17-3-1-4-19(23)15-17)10-2-9-25-11-13-28-14-12-25/h1,3-8,15H,2,9-14,16H2,(H,24,27) |
| InChIKey | CMLJQIIMZPBXHC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |