C20H30IN5O4 — CID 111346482
N-ethyl-4-(morpholine-4-carbonyl)-N'-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111346482) has the molecular formula C20H30IN5O4 and a molecular weight of 531.40 g/mol. Its IUPAC name is N-ethyl-4-(morpholine-4-carbonyl)-N'-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(morpholine-4-carbonyl)-N'-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111346482 |
| Molecular Formula | C20H30IN5O4 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | N-ethyl-4-(morpholine-4-carbonyl)-N'-[(3-nitrophenyl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc([N+](=O)[O-])c1)N1CCC(C(=O)N2CCOCC2)CC1.I |
| InChI | InChI=1S/C20H29N5O4.HI/c1-2-21-20(22-15-16-4-3-5-18(14-16)25(27)28)24-8-6-17(7-9-24)19(26)23-10-12-29-13-11-23;/h3-5,14,17H,2,6-13,15H2,1H3,(H,21,22);1H |
| InChIKey | SVYMLJXBFILKFS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|